| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Androst-4-ene-3,17-dione |
|---|---|
| Synonyms | (10R,13S) |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 |
| CAS Registry Number | 897039-79-1 |
| SMILES | O=C4/C=C3/CCC2C(CCC1(C(=O)CCC12)C)C3(C)CC4 |
| InChI | 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3 |
| InChIKey | AEMFNILZOJDQLW-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.435°C at 760 mmHg (Cal.) |
| Flash point | 161.131°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |