| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Styron G 9001 |
| Synonyms | Methacrylic Acid; Styrene; Ethenylbenzene; 2-Methylprop-2-Enoic Acid; 2-Propenoic Acid, 2-Methyl-, Polymer With Ethenylbenzene |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 9010-92-8 |
| SMILES | CC(C(=O)O)=C.C1=C(C=CC=C1)C=C |
| InChI | 1S/C8H8.C4H6O2/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h2-7H,1H2;1H2,2H3,(H,5,6) |
| InChIKey | CVEPFOUZABPRMK-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |