|
CAS#: 9010-93-9 Product: 2-Methyl-2-propenoic acid polymer with 1,3-butadiene and ethenylbenzene No suppilers available for the product. |
| Name | 2-Methyl-2-propenoic acid polymer with 1,3-butadiene and ethenylbenzene |
|---|---|
| Synonyms | Buta-1,3-Diene; Methacrylic Acid; Styrene; Buta-1,3-Diene; Ethenylbenzene; 2-Methylprop-2-Enoic Acid |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 |
| CAS Registry Number | 9010-93-9 |
| SMILES | CC(C(=O)O)=C.C1=C(C=CC=C1)C=C.C(C=C)=C |
| InChI | 1S/C8H8.C4H6O2.C4H6/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6;1-3-4-2/h2-7H,1H2;1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | LKAVYBZHOYOUSX-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |