|
CAS#: 9011-87-4 Product: Methyl acrylate-methyl methacrylate copolymer No suppilers available for the product. |
| Name | Methyl acrylate-methyl methacrylate copolymer |
|---|---|
| Synonyms | 2-Methylprop-2-Enoate; 2-Methylprop-2-Enoic Acid Methyl Ester; Methacrylate; 2-Methylacrylic Acid Methyl Ester; 2-Propenoic Acid, 2-Methyl-, Methyl Ester, Polymer With Methyl 2-Propenoate |
| Molecular Formula | C9H13O4 |
| Molecular Weight | 185.20 |
| CAS Registry Number | 9011-87-4 |
| SMILES | CC(C(OC)=O)=C.CC(C([O-])=O)=C |
| InChI | 1S/C5H8O2.C4H6O2/c1-4(2)5(6)7-3;1-3(2)4(5)6/h1H2,2-3H3;1H2,2H3,(H,5,6)/p-1 |
| InChIKey | IWVKTOUOPHGZRX-UHFFFAOYSA-M |
| Boiling point | 100.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 10°C (Cal.) |
| Market Analysis Reports |