| Sinova Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (301) 961-1525 | |||
![]() |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 5-Methoxyisophthalic acid |
|---|---|
| Synonyms | 5-Methoxy-1,3-dicarboxylic acid; 5-Methoxy-isophathalic acid; 5-METHOXYISOPHTHALICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 90560-22-8 |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)C(=O)O |
| InChI | 1S/C9H8O5/c1-14-7-3-5(8(10)11)2-6(4-7)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | POSMIIJADZKUPL-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 270°C (Expl.) |
| Boiling point | 440.8±30.0°C at 760 mmHg (Cal.) |
| Flash point | 183.6±18.1°C (Cal.) |
| (1) | Kai Jiang, Lu-Fang Ma, Xiao-Yuan Sun and Li-Ya Wang. Syntheses, structures and luminescent properties of zinc(ii) coordination polymers based on bis(imidazole) and dicarboxylate, CrystEngComm, 2011, 13, 330. |
|---|---|
| Market Analysis Reports |