|
CAS#: 9060-33-7 Product: Diethenylbenzene, polymer with 2-methyl-1,3-butadiene and 2-methyl-1-propene No suppilers available for the product. |
| Name | Diethenylbenzene, polymer with 2-methyl-1,3-butadiene and 2-methyl-1-propene |
|---|---|
| Synonyms | 1,2-Divinylbenzene; Isoprene; 2-Methylprop-1-Ene; 1,2-Divinylbenzene; Isobutylene; Isoprene |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.41 |
| CAS Registry Number | 9060-33-7 |
| SMILES | C1=C(C(=CC=C1)C=C)C=C.CC(C=C)=C.CC(=C)C |
| InChI | 1S/C10H10.C5H8.C4H8/c1-3-9-7-5-6-8-10(9)4-2;1-4-5(2)3;1-4(2)3/h3-8H,1-2H2;4H,1-2H2,3H3;1H2,2-3H3 |
| InChIKey | DBOFPRDNHUMHGD-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| Market Analysis Reports |