| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | N,N-Diethylcyclohexylamine |
|---|---|
| Synonyms | Cyclohexyl-Diethyl-Amine; Inchi=1/C10h21n/C1-3-11(4-2)10-8-6-5-7-9-10/H10h,3-9H2,1-2H; Cyclohexanamine, N,N-Diethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 |
| CAS Registry Number | 91-65-6 |
| EINECS | 202-087-2 |
| SMILES | C(N(C1CCCCC1)CC)C |
| InChI | 1S/C10H21N/c1-3-11(4-2)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | CIXSDMKDSYXUMJ-UHFFFAOYSA-N |
| Density | 0.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.885°C at 760 mmHg (Cal.) |
| Flash point | 57.778°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Linnan He and Peter C. Jurs. Assessing the Reliability of a QSAR Model's Predictions, J. Mol. Graphics Modell. 2005, 23(6), 503-523 |
|---|---|
| Market Analysis Reports |