|
CAS#: 918-54-7 Product: 2,2,2-Trinitroethanol No suppilers available for the product. |
| Name | 2,2,2-Trinitroethanol |
|---|---|
| Synonyms | 4-01-00-01389 (Beilstein Handbook Reference); Brn 1790157; Ethanol, 2,2,2-Trinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C2H3N3O7 |
| Molecular Weight | 181.06 |
| CAS Registry Number | 918-54-7 |
| SMILES | C(O)C([N+]([O-])=O)([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C2H3N3O7/c6-1-2(3(7)8,4(9)10)5(11)12/h6H,1H2 |
| InChIKey | JGAGBYRIJUMEDB-UHFFFAOYSA-N |
| Density | 1.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.792°C at 760 mmHg (Cal.) |
| Flash point | 108.426°C (Cal.) |
| (1) | M. Göbel and T. M. Klapötke. 2,2,2-Trinitroethanol, Acta Cryst. (2007). C63, o562-o564 |
|---|---|
| Market Analysis Reports |