| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 1,1,1-Triphenyl-N-(3-pyridinylmethyl)methanamine |
|---|---|
| Synonyms | (3-TRIBENZYLAMINOMETHYL)PYRIDINE; N-Trityl-3-pyridinemethanamine; Pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.46 |
| CAS Registry Number | 918311-87-2 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NCC4=CN=CC=C4 |
| InChI | 1S/C25H22N2/c1-4-12-22(13-5-1)25(23-14-6-2-7-15-23,24-16-8-3-9-17-24)27-20-21-11-10-18-26-19-21/h1-19,27H,20H2 |
| InChIKey | PQFNWDHABGBCHB-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.0±40.0°C at 760 mmHg (Cal.) |
| Flash point | 255.0±27.3°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| solubility | Soluble to 50 mM in DMSO and to 25 mM in ethanol |
| SDS | Available |
|---|---|
| Market Analysis Reports |