| Zhejiang Chempharm Industry&trading Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.chempharm.cn | |||
![]() | +86 (571) 8770-1568 | |||
![]() | export@chempharm.cn | |||
| Chemical distributor since 1996 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Classification | Organic raw materials >> Amino compound >> Amide compound |
|---|---|
| Name | 3,5-Dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12Cl3N3O |
| Molecular Weight | 332.61 |
| CAS Registry Number | 920509-27-9 |
| SMILES | CC(C)C1=CC(=NN=C1Cl)OC2=C(C=C(C=C2Cl)N)Cl |
|
3,5-Dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline is a synthetic compound that has attracted much attention due to its great potential in various fields, especially pharmaceutical and agricultural fields. The discovery of 3,5-dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline stems from the exploration of new compounds with potent biological activities. Researchers aim to develop molecules with enhanced efficacy and specificity for therapeutic and agricultural applications. The synthesis involves the strategic modification of aniline derivatives, incorporating a pyridazinone moiety to achieve the desired biological activity. 3,5-Dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline has several key properties that make it valuable in various applications. Its molecular formula is C14H12Cl3N3O and its molecular weight is 344.63 g/mol. The structural features of this compound, including the aniline ring, chlorophenoxy and pyridazinone moieties, make it stable and reactive. Its solubility and interaction with biological targets are crucial to its efficacy in different uses. One of the main applications of this compound is in pharmaceuticals. It has shown promise as a therapeutic agent due to its potential to interact with specific biological targets. Studies have shown that it may be useful in treating various diseases, including cancer and inflammation. Its ability to modulate specific pathways and enzymes makes it a candidate for the development of new drugs with targeted effects. In agriculture, 3,5-dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline is used as a herbicide. Its structure enables it to inhibit the growth of certain weeds without affecting crops. The selective herbicidal activity of this compound is beneficial for maintaining crop health and yield. In addition to direct applications, this compound is also valuable in research and development. It is a lead compound for the development of new derivatives with enhanced properties. Researchers explore modifications to its structure to improve its biological activity, selectivity, and safety. The synthesis of 3,5-dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline is also of great significance in chemical research. Its synthesis involves advanced organic chemistry techniques that provide insights into the generation of complex molecules. The methods developed for its synthesis can be applied to other chemical processes, advancing the field of synthetic organic chemistry. The future of 3,5-dichloro-4-((6-chloro-5-isopropylpyridazin-3-yl)oxy)aniline lies in its further exploration through clinical trials and agricultural research. Understanding its pharmacokinetics, long-term effects, and environmental impacts are essential for its development and safe application. Innovations in synthetic methods and derivative development may enhance its efficacy and expand its use. References none |
| Market Analysis Reports |