| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | 2,4-Dihydroxybenzophenone |
|---|---|
| Synonyms | (2,4-Dihydroxyphenyl)-Phenyl-Methanone; 126217_Aldrich; 2,4-Dihydroxybenzophenone |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 92092-63-2 |
| SMILES | C1=CC(=CC(=C1C(=O)C2=CC=CC=C2)O)O |
| InChI | 1S/C13H10O3/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| InChIKey | ZXDDPOHVAMWLBH-UHFFFAOYSA-N |
| Density | 1.32 (Expl.) |
|---|---|
| 1.3±0.1g/cm3 (Cal.) | |
| Melting point | 144°C (Expl.) |
| Boiling point | 409.0±14.0°C at 760 mmHg (Cal.) |
| 194°C (Expl.) | |
| Flash point | 215.3±16.6°C (Cal.) |
| 125°C (Expl.) | |
| Safety Code | S26 Details |
|---|---|
| Risk Code | R36 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| (1) | Tatsuya Kunisue, Qian Wu, Shinsuke Tanabe, Kenneth M. Aldous and Kurunthachalam Kannan. Analysis of five benzophenone-type UV filters in human urine by liquid chromatography-tandem mass spectrometry, Anal. Methods, 2010, 2, 707. |
|---|---|
| Market Analysis Reports |