|
CAS#: 92210-53-2 Product: 3-Nitro-2H-chromene No suppilers available for the product. |
| Name | 3-Nitro-2H-chromene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 92210-53-2 |
| SMILES | O=N(=O)C\1=C\c2ccccc2OC/1 |
| InChI | 1S/C9H7NO3/c11-10(12)8-5-7-3-1-2-4-9(7)13-6-8/h1-5H,6H2 |
| InChIKey | PNXCGUHRJZGVPT-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.847°C at 760 mmHg (Cal.) |
| Flash point | 156.667°C (Cal.) |
| (1) | Jian-Wu Xie, Li-Ping Fan, Hong Su, Xin-Sheng Li and Dong-Cheng Xu. Efficient kinetic resolution of racemic 3-nitro-2H-chromene derivatives catalyzed by Takemoto's organocatalyst, Org. Biomol. Chem., 2010, 8, 2117. |
|---|---|
| Market Analysis Reports |