| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| Synonyms | 3-Methylisoxazole-4-carboxylic acid methyl ester; InChI=1/C6H7NO3/c1-4-5(3-10-7-4)6(8)9-2/h3H,1-2H3; methyl 3-methylisoxazole-4-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.12 |
| CAS Registry Number | 92234-50-9 |
| SMILES | CC1=NOC=C1C(=O)OC |
| InChI | 1S/C6H7NO3/c1-4-5(3-10-7-4)6(8)9-2/h3H,1-2H3 |
| InChIKey | QLWCWMCZEGJNQO-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.8±20.0°C at 760 mmHg (Cal.) |
| Flash point | 80.1±21.8°C (Cal.) |
| (1) | Connie K. Y. Lee, Christopher J. Easton, Mariana Gebara-Coghlan, Leo Radom, Anthony P. Scott, Gregory W. Simpson and Anthony C. Willis. Substituent effects in isoxazoles: identification of 4-substituted isoxazoles as Michael acceptors, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 2031. |
|---|---|
| Market Analysis Reports |