| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1-(trans-4-Hexylcyclohexyl)-4-isothiocyanatobenzene |
|---|---|
| Synonyms | 4-(4-isothiocyanatophenyl)-1-(4-trans-hexyl)cyclohexane; 4-(trans-4′-n-hexylcyclohexyl)isothiocyanatobenzene; 4-(trans-4-Hexylcyclohexyl)phenyl isothiocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.49 |
| CAS Registry Number | 92444-14-9 |
| SMILES | S=C=N\c1ccc(cc1)[C@@H]2CC[C@@H](CCCCCC)CC2 |
| InChI | 1S/C19H27NS/c1-2-3-4-5-6-16-7-9-17(10-8-16)18-11-13-19(14-12-18)20-15-21/h11-14,16-17H,2-10H2,1H3/t16-,17- |
| InChIKey | STLICVZWECVJDT-QAQDUYKDSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.475°C at 760 mmHg (Cal.) |
| Flash point | 222.499°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zuzana Mitróová, Natália TomaÅ¡oviÄová, Milan Timko, Martina Koneracká, Jozef KováÄ, Jan Jadzyn, Ivo Vávra, Nándor Éber, Tibor Tóth-Katona, Eric Beaugnon, Xavier Chaud and Peter KopÄanskà ½. The sensitivity of liquid crystal doped with functionalized carbon nanotubes to external magnetic fields, New J. Chem., 2011, 35, 1260. |
|---|---|
| Market Analysis Reports |