| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Beijing LYS Chemicals Co, Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (10) 6841-8738 | |||
![]() |
jiayanyong@lyschem.com | |||
| Chemical manufacturer since 2004 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Extrasynthese Chemical S.A.S. | France | |||
|---|---|---|---|---|
![]() |
+33 (47) 898-2034 | |||
![]() |
info@extrasynthese.com | |||
| Chemical manufacturer | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 3-Methylbutanoic acid |
|---|---|
| Synonyms | 3-Methylbutyric Acid; Inchi=1/C5h10o2/C1-4(2)3-5(6)7/H4h,3H2,1-2H3,(H,6,7; 3,4-Diisovaleryl Adrenaline |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 |
| CAS Registry Number | 92634-50-9 |
| SMILES | C(C(C)C)C(O)=O |
| InChI | 1S/C5H10O2/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | GWYFCOCPABKNJV-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 20 (Expl.) | |
| Melting point | -33°C (Expl.) |
| Boiling point | 175.3±8.0°C at 760 mmHg (Cal.) |
| 175°C (Expl.) | |
| Flash point | 70°C (Expl.) |
| 73.4±6.9°C (Cal.) | |
| Refractive index | 1.403 (Expl.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: POISON, irritates skin, eyes, lungs |
| DANGER: CORROSIVE, burns skin and eyes | |
| (1) | Tamaz Guliashvili, Julius Tibbelin, Jiyeon Ryu and Henrik Ottosson. Unsuccessful attempts to add alcohols to transient 2-amino-2-siloxy-silenes - leading to a new benign route for base-free alcohol protection, Dalton Trans., 2010, 39, 9379. |
|---|---|
| Market Analysis Reports |