| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | (Z)-2-Butenediamide |
| Synonyms | Inchi=1/C4h6n2o2/C5-3(7)1-2-4(6)8/H1-2H,(H2,5,7)(H2,6,8)/B2-1; But-2-Enedioic Acid, Diamide; 2-Butenediamide, (Z)- |
| Molecular Structure | ![]() |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 |
| CAS Registry Number | 928-01-8 |
| EINECS | 213-168-7 |
| SMILES | O=C(\C=C/C(N)=O)N |
| InChI | 1S/C4H6N2O2/c5-3(7)1-2-4(6)8/h1-2H,(H2,5,7)(H2,6,8)/b2-1- |
| InChIKey | BSSNZUFKXJJCBG-UPHRSURJSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.83°C at 760 mmHg (Cal.) |
| Flash point | 233.107°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |