|
CAS#: 93-43-6 Product: 2-Naphthyl lactate No suppilers available for the product. |
| Name | 2-Naphthyl lactate |
|---|---|
| Synonyms | 2-Naphthyl 2-Hydroxypropanoate; 2-Hydroxypropanoic Acid 2-Naphthyl Ester; 2-Hydroxypropionic Acid 2-Naphthyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 93-43-6 |
| EINECS | 202-246-6 |
| SMILES | C1=CC2=C(C=C1)C=C(OC(=O)C(O)C)C=C2 |
| InChI | 1S/C13H12O3/c1-9(14)13(15)16-12-7-6-10-4-2-3-5-11(10)8-12/h2-9,14H,1H3 |
| InChIKey | RTXHNOBSQMHTSB-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.661°C at 760 mmHg (Cal.) |
| Flash point | 167.303°C (Cal.) |
| (1) | Jonathan Sperry, Jennifer S. Gibson, Jimmy J. P. Sejberg and Margaret A. Brimble. Enantioselective synthesis of the dimeric pyranonaphthoquinone core of the cardinalins using a late-stage homocoupling strategy, Org. Biomol. Chem., 2008, 6, 4261. |
|---|---|
| Market Analysis Reports |