| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1-Chloro-4-methylcyclohexane |
|---|---|
| Synonyms | 1-Chloro-4-Methyl-Cyclohexane; Inchi=1/C7h13cl/C1-6-2-4-7(8)5-3-6/H6-7H,2-5H2,1H3/T6-,7; Cis-1-Chloro-4-Methylcyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13Cl |
| Molecular Weight | 132.63 |
| CAS Registry Number | 931-68-0 |
| SMILES | CC1CCC(Cl)CC1 |
| InChI | 1S/C7H13Cl/c1-6-2-4-7(8)5-3-6/h6-7H,2-5H2,1H3 |
| InChIKey | KNEUJTFLMQRIFD-UHFFFAOYSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 165.475°C at 760 mmHg (Cal.) |
| Flash point | 41.784°C (Cal.) |
| (1) | Thaler et al.. Highly diastereoselective Csp3-Csp2 Negishi cross-coupling with 1,2-, 1,3- and 1,4-substituted cycloalkylzinc compounds, Nature Chemistry, 2010 |
|---|---|
| Market Analysis Reports |