| Chizhou Dongsheng Pharmaceutical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.dspharmchem.com | |||
![]() | +86 (576) 8429-2571 | |||
![]() | +86 (576) 8429-2560 | |||
![]() | ksz@dspharmchem.com | |||
| Chemical manufacturer since 1995 | ||||
| chemBlink Premium supplier since 2011 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 3-Fluoro-4-morpholinoaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 |
| CAS Registry Number | 93246-53-8 |
| EC Number | 676-003-1 |
| SMILES | C1COCCN1C2=C(C=C(C=C2)N)F |
| Melting point | 123 °C |
|---|---|
| Hazard Symbols | |||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302+H312+H332-H302-H312-H315-H319-H332-H335-H413 Details | ||||||||||||||||||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P273-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||||||||||
|
3-Fluoro-4-morpholinoaniline is an important compound in the field of organic chemistry and materials science. This molecule features a fluorine atom and a morpholino group attached to an aniline ring, which imparts distinctive chemical and physical properties. The discovery of 3-fluoro-4-morpholinoaniline is part of ongoing research aimed at developing new chemical entities with enhanced properties. The incorporation of a fluorine atom into the aniline ring modifies its electronic properties, making the compound more reactive and potentially improving its performance in various applications. The morpholino group contributes to the molecule's stability and solubility, which are critical for its utility in diverse chemical processes. In medicinal chemistry, 3-fluoro-4-morpholinoaniline has potential applications as a pharmaceutical intermediate. The fluorine atom enhances the compound's ability to interact with biological targets, while the morpholino group can improve pharmacokinetics and bioavailability. Research indicates that similar compounds can exhibit significant biological activities, including antimicrobial and anticancer properties. Therefore, 3-fluoro-4-morpholinoaniline could serve as a precursor for developing new therapeutic agents with enhanced efficacy. In materials science, 3-fluoro-4-morpholinoaniline's unique structure makes it a valuable building block for the synthesis of advanced materials. The fluorine atom and morpholino group can influence the material's properties, such as thermal stability and mechanical strength. This capability is particularly useful for designing high-performance materials used in electronics, coatings, and other industrial applications. Additionally, the compound plays a role in organic synthesis as a versatile reagent. Its functional groups enable it to participate in various chemical reactions, leading to the formation of more complex molecules. This versatility enhances its value in creating new chemical products and developing novel synthetic methodologies. Overall, 3-fluoro-4-morpholinoaniline represents a significant advancement in chemical research with promising applications in pharmaceuticals, materials science, and organic synthesis. References 2022. Synthesis, Docking and Antibacterial Evaluation of N-(1-(3-Fluoro-4-morpholinophenyl)-1H-tetrazol-5-yl) Amides. Chemistry Africa, 5(3). DOI: 10.1007/s42250-022-00347-y 2020. Synthesis, spectral studies, molecular structure determination by single crystal X-ray diffraction of (E)-1-(((3-fluoro-4-morpholinophenyl)imino)methyl)napthalen-2-ol and computational studies by Austin model-1(AM1), MM2 and DFT/B3LYP. SN Applied Sciences, 2(10). DOI: 10.1007/s42452-020-03525-0 2017. Sulfonamides and carbamates of 3-fluoro-4-morpholinoaniline (linezolid intermediate): synthesis, antimicrobial activity and molecular docking study. Research on Chemical Intermediates, 43(12). DOI: 10.1007/s11164-017-3114-1 |
| Market Analysis Reports |