|
CAS#: 93264-02-9 Product: 5,5-Difluorocamphor No suppilers available for the product. |
| Name | 5,5-Difluorocamphor |
|---|---|
| Synonyms | 5,5-Difluoro-1,7,7-Trimethyl-Norbornan-2-One; 5,5-Difluoro-1,7,7-Trimethyl-2-Norbornanone; 5,5-Difluoro-1,7,7-Trimethyl-Bicyclo[2.2.1]Heptan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14F2O |
| Molecular Weight | 188.22 |
| CAS Registry Number | 93264-02-9 |
| SMILES | CC12C(C(C(F)(F)C1)CC2=O)(C)C |
| InChI | 1S/C10H14F2O/c1-8(2)6-4-7(13)9(8,3)5-10(6,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | GWEZLPSFDXSFNQ-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.891°C at 760 mmHg (Cal.) |
| Flash point | 75.083°C (Cal.) |
| (1) | Sun Hee Kim, Tran-Chin Yang, Roshan Perera, Shengxi Jin, Thomas A. Bryson, Masanori Sono, Roman Davydov, John H. Dawson and Brian M. Hoffman. Cryoreduction EPR and C, F ENDOR study of substrate-bound substates and solvent kinetic isotope effects in the catalytic cycle of cytochrome P450cam and its T252A mutant, Dalton Trans., 2005, 0, 3464. |
|---|---|
| Market Analysis Reports |