Online Database of Chemicals from Around the World

1-(2-Cyanophenyl)piperidine-4-carboxylic acid
[CAS 937601-79-1]

List of Suppliers
Zhengzhou Kingorgchem Chemical Technology Co., Ltd. China
www.kingorgchem.com
+86 (371) 6551-1006
+86 (371) 6575-6965
sales@kingorgchem.com
QQ Chat
WeChat: 18625597674
Chemical manufacturer since 2015
chemBlink Standard supplier since 2016

Identification
ClassificationOrganic raw materials >> Heterocyclic compound >> Piperidines
Name1-(2-Cyanophenyl)piperidine-4-carboxylic acid
Molecular Structure1-(2-Cyanophenyl)piperidine-4-carboxylic acid molecular structure (CAS 937601-79-1)
Molecular FormulaC13H14N2O2
Molecular Weight230.26
CAS Registry Number937601-79-1
SMILESC1CN(CCC1C(=O)O)C2=CC=CC=C2C#N
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
1-(2-Cyanophenyl)piperidine-4-carboxylic acid is a notable chemical compound featuring a piperidine ring substituted with both a cyano group and a carboxylic acid group. The molecule is characterized by its unique structure, where a cyanophenyl group is attached to the piperidine ring at the 1-position, and a carboxylic acid is present at the 4-position of the piperidine ring. This compound has gained attention in various fields due to its potential applications in medicinal chemistry and organic synthesis.

The discovery of 1-(2-cyanophenyl)piperidine-4-carboxylic acid is part of the broader research into piperidine derivatives, which are known for their diverse biological activities. Piperidine is a six-membered heterocyclic ring with a nitrogen atom, and its derivatives are often explored for their pharmacological properties. The introduction of both the cyano group and the carboxylic acid group into the piperidine ring provides unique reactivity and enhances the compound's potential as a drug candidate.

In medicinal chemistry, 1-(2-cyanophenyl)piperidine-4-carboxylic acid has been studied for its potential therapeutic applications. The cyano group is known for its ability to participate in various chemical transformations, while the carboxylic acid group can act as a functional handle for further modification. The combination of these groups makes the compound a valuable intermediate in the synthesis of biologically active molecules. For instance, derivatives of this compound have been investigated for their potential as analgesics, anti-inflammatory agents, and central nervous system modulators. The presence of the cyano group can influence the binding affinity of the molecule to its target receptors, while the carboxylic acid group can facilitate interactions with other molecules.

The compound is also utilized in organic synthesis as a building block for the creation of more complex structures. Its reactivity allows for the formation of various derivatives through esterification, amidation, and other chemical transformations. These derivatives can be used in the development of new materials, pharmaceuticals, and agrochemicals. The versatility of 1-(2-cyanophenyl)piperidine-4-carboxylic acid makes it a valuable tool in the design of new compounds with specific properties.

In addition to its role in medicinal chemistry and organic synthesis, the compound has been explored for its potential in materials science. The cyano and carboxylic acid groups provide functional sites that can be utilized in the development of new materials with tailored properties. For example, the compound can be incorporated into polymers or other materials to impart specific chemical or physical characteristics. This application is of particular interest in the development of advanced materials for electronic devices, sensors, and other technological applications.

The ongoing research into 1-(2-cyanophenyl)piperidine-4-carboxylic acid highlights its importance in both pharmaceutical and materials science. Its unique structure and reactivity offer opportunities for the development of new drugs and materials with enhanced properties. As scientists continue to explore its applications, this compound remains a valuable component in the advancement of chemistry and related fields.

References

none
Market Analysis Reports
Related Products
1-(4-Cyanopheny...  1-(2-Cyanopheny...  1-(3-Cyanopheny...  (4-Cyano-Phenyl...  (3-Cyano-Phenyl...  1-(2-Cyanopheny...  4-(4-Cyanopheny...  N-[[4-(2-Cyanop...  4-(4'-Cyanophen...  1-(4-Cyanopheny...  4-Cyano-4-pheny...  rac-1-[2-(Cyano...  1-(4-Cyanopheny...  1-(3-Cyanopheny...  2-(4-Cyanopheny...  N'-(4-Cyanophen...  3-Cyano-3-Pheny...  3-(2-Cyanopheny...  3-(4-Cyanopheny...  2-Cyano-3-pheny...