| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Aronis | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Ethylene glycol dibenzoate |
| Synonyms | Benzoic Acid 2-(Oxo-Phenylmethoxy)Ethyl Ester; Benzoic Acid 2-(Benzoyloxy)Ethyl Ester; 2-Phenylcarbonyloxyethyl Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 94-49-5 (9004-86-8) |
| EINECS | 202-338-6 |
| SMILES | C2=C(C(OCCOC(=O)C1=CC=CC=C1)=O)C=CC=C2 |
| InChI | 1S/C16H14O4/c17-15(13-7-3-1-4-8-13)19-11-12-20-16(18)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | XFDQLDNQZFOAFK-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Melting point | 70°C (Expl.) |
| Boiling point | 407.994°C at 760 mmHg (Cal.) |
| Flash point | 205.281°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |