| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Dr. Ehrenstorfer GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (821) 906-080 | |||
![]() |
info@analytical-standards.com | |||
| Chemical manufacturer | ||||
| Name | N-[[[4-[[[(E)-[(4-Chlorophenyl)Cyclopropylmethylene]Amino]Oxy]Methyl]Phenyl]Amino]Carbonyl]-2,6-Difluoro-Benzamide |
|---|---|
| Synonyms | 1-(Α-(4-Chloro-Α-Cyclopropylbenzylideneaminooxy)-P-Tolyl)-3-(2,6-Difluorobenzoyl)Urea(Ratio 50 To 80% (E) And 50 To 20% (Z)Isomers); N-(((4-Chlorophenyl) Cyclopropylmethylene Amino) Oxy) Methyl Phenyl Amino Carbonyl-2,6-Difluorobenzamide; 1-[Α-(4-Chloro-Α-Cyclopropylbenzylideneaminooxy)-P-Toly]-3-(2,6-Diflurorobenzoyl) Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C25H20ClF2N3O3 |
| Molecular Weight | 483.89 |
| CAS Registry Number | 94050-52-9 |
| SMILES | Clc1ccc(cc1)/C(=N\ON(C(=O)c1c(F)cc(c(c1F)c1ccccc1)C)C(=O)N)/C1CC1 |
| InChI | 1S/C25H20ClF2N3O3/c1-14-13-19(27)21(22(28)20(14)15-5-3-2-4-6-15)24(32)31(25(29)33)34-30-23(16-7-8-16)17-9-11-18(26)12-10-17/h2-6,9-13,16H,7-8H2,1H3,(H2,29,33)/b30-23- |
| Market Analysis Reports |