| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4,6,8-Trimethylazulene |
|---|---|
| Synonyms | Stock1n-11515; 2,4,6-Trimethylbicyclo[5.3.0]Deca-2,4,6,8,10-Pentaene; Azulene, 4,6,8-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 941-81-1 |
| EINECS | 213-383-6 |
| SMILES | CC2=C1C(=CC=C1)C(=CC(=C2)C)C |
| InChI | 1S/C13H14/c1-9-7-10(2)12-5-4-6-13(12)11(3)8-9/h4-8H,1-3H3 |
| InChIKey | RUNBRXWUHPOTOO-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Melting point | 80-82°C (Expl.) |
| Boiling point | 284.652°C at 760 mmHg (Cal.) |
| Flash point | 126.16°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Kazuhiro Tsuchiya, Keiko Ideta, Koichi Mogi, Yusuke Sunada and Hideo Nagashima. Experimental and theoretical aspects of the haptotropic rearrangement of diiron and dirutheniumcarbonyl complexes bound to 4,6,8-trimethylazulene, Dalton Trans., 2008, 2708. |
|---|---|
| Market Analysis Reports |