| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,6-Dimethoxyphenyl acetate |
|---|---|
| Synonyms | Acetic Acid (2,6-Dimethoxyphenyl) Ester; (2,6-Dimethoxyphenyl) Ethanoate; 2-Acetyl-1,3-Dimethylpyrogallol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 944-99-0 |
| SMILES | C1=CC=C(C(=C1OC)OC(C)=O)OC |
| InChI | 1S/C10H12O4/c1-7(11)14-10-8(12-2)5-4-6-9(10)13-3/h4-6H,1-3H3 |
| InChIKey | CIIHIFFNYMLOAV-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.822°C at 760 mmHg (Cal.) |
| Flash point | 91.425°C (Cal.) |
| (1) | Kai Bao, Aixue Fan, Yi Dai, Liang Zhang, Weige Zhang, Maosheng Cheng and Xinsheng Yao. Selective demethylation and debenzylation of aryl ethers by magnesium iodide under solvent-free conditions and its application to the total synthesis of natural products, Org. Biomol. Chem., 2009, 7, 5084. |
|---|---|
| Market Analysis Reports |