| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | O-(3,4-Dimethylphenyl) O,O-dimethyl phosphorothioate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H15O3PS |
| Molecular Weight | 246.26 |
| CAS Registry Number | 94734-40-4 |
| SMILES | CC1=C(C=C(C=C1)OP(=S)(OC)OC)C |
| InChI | 1S/C10H15O3PS/c1-8-5-6-10(7-9(8)2)13-14(15,11-3)12-4/h5-7H,1-4H3 |
| InChIKey | VFPIDMNBRBLUSR-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.5±50.0°C at 760 mmHg (Cal.) |
| Flash point | 134.3±30.1°C (Cal.) |
| (1) | C. G. Zambonin, I. Losito, A. Cilenti and F. Palmisano. Solid-phase microextraction coupled to gas chromatography-mass spectrometry for the study of soil adsorption coefficients of organophosphorus pesticides, J. Environ. Monit., 2002, 4, 477. |
|---|---|
| Market Analysis Reports |