| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,3-Trimethylbenzene |
|---|---|
| Synonyms | Chebi:34039; Inchi=1/C9h12/C1-7-4-5-8(2)9(3)6-7/H4-6H,1-3H; C14533 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 |
| CAS Registry Number | 95-36-3 |
| SMILES | C1=C(C)C=CC(=C1C)C |
| InChI | 1S/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| InChIKey | GWHJZXXIDMPWGX-UHFFFAOYSA-N |
| Density | 20 (Expl.) |
|---|---|
| 0.9±0.1g/cm3 (Cal.) | |
| Melting point | -43.8°C (Expl.) |
| Boiling point | 170.8±20.0°C at 760 mmHg (Cal.) |
| 169.4444°C (Expl.) | |
| Flash point | 48.889°C (Cal.) |
| 44.4444°C (Expl.) | |
| Refractive index | 1.504 (Expl.) |
| solubility | 0.006% |
| Safety Code | S26;S61 Details |
|---|---|
| Risk Code | R10;R20;R36/37/38;R51/53 Details |
| Hazard Symbol | X;N Details |
| Transport Information | UN3295 |
| Safety Description | Safety glasses, adequate ventilation. |
| DANGER: FLAMMABLE; Causes CNS effects; irritates skin, lungs | |
| HARMFUL TO THE ENVIRONMENT / HARMFUL / IRRITANT | |
| (1) | Lygia T. Budnik, Svea Fahrenholtz, Stefan Kloth and Xaver Baur. Halogenated hydrocarbon pesticides and other volatile organic contaminants provide analytical challenges in global trading, J. Environ. Monit., 2010, 12, 936. |
|---|---|
| Market Analysis Reports |