| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | trans-(-)-2-Phenylcyclopropanamine |
|---|---|
| Synonyms | (1R,2S)-2-Phenyl-1-Cyclopropanamine; [(1R,2S)-2-Phenylcyclopropyl]Amine; (1R,2S)-2-Phenylcyclopropanamine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 |
| CAS Registry Number | 95-62-5 (3721-26-4;3721-28-6) |
| SMILES | [C@@H]1([C@@H](C1)C2=CC=CC=C2)N |
| InChI | 1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9+/m0/s1 |
| InChIKey | AELCINSCMGFISI-DTWKUNHWSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.268°C at 760 mmHg (Cal.) |
| Flash point | 90.766°C (Cal.) |
| (1) | Isabella Hyla-Kryspin, Stefan Grimme, Svenja Hruschka and Günter Haufe. Conformational preferences and basicities of monofluorinated cyclopropyl amines in comparison to cyclopropylamine and 2-fluoroethylamine, Org. Biomol. Chem., 2008, 6, 4167. |
|---|---|
| Market Analysis Reports |