| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Livchem Logistics GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-(10,15,20-Triphenyl-5-porphyrinyl)benzoic acid |
|---|---|
| Synonyms | 5-(4-Carboxyphenyl)-10,15,20-triphenyl-21H,23H-porphine; 5-(4'-carboxyphenyl)-10,15,20-triphenylporphyrin; 5-(4-carboxyphenyl)-10,15,20-triphenyl-porphyrin |
| Molecular Structure | ![]() |
| Molecular Formula | C45H30N4O2 |
| Molecular Weight | 658.75 |
| CAS Registry Number | 95051-10-8 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=C(C=C8)C(=O)O)C=C4)C9=CC=CC=C9)N3 |
| InChI | 1S/C45H30N4O2/c50-45(51)32-18-16-31(17-19-32)44-39-26-24-37(48-39)42(29-12-6-2-7-13-29)35-22-20-33(46-35)41(28-10-4-1-5-11-28)34-21-23-36(47-34)43(30-14-8-3-9-15-30)38-25-27-40(44)49-38/h1-27,46,49H,(H,50,51)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | GZTMFXHPFNRUNU-LWQDQPMZSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| SDS | Available |
|---|---|
| (1) | Gennaro Pescitelli, Lorenzo Di Bari and Nina Berova. Conformational aspects in the studies of organic compounds by electronic circular dichroism, Chem. Soc. Rev., 2011, 40, 4603. |
|---|---|
| Market Analysis Reports |