| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 1-Benzyl-1,4-dihydronicotinamide |
|---|---|
| Synonyms | 1-(Benzyl)-4H-Pyridine-3-Carboxamide; Cbmicro_010868; 1,4-Dihydro-N-1-Benzylnicotinamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 |
| CAS Registry Number | 952-92-1 |
| SMILES | C2=C(CN1C=C(CC=C1)C(N)=O)C=CC=C2 |
| InChI | 1S/C13H14N2O/c14-13(16)12-7-4-8-15(10-12)9-11-5-2-1-3-6-11/h1-6,8,10H,7,9H2,(H2,14,16) |
| InChIKey | CMNUYDSETOTBDE-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Melting point | 121°C (Expl.) |
| Boiling point | 433.398°C at 760 mmHg (Cal.) |
| Flash point | 215.912°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Motonobu Murakami, Kei Ohkubo, Taku Hasobe, Vito Sgobba, Dirk M. Guldi, Florian Wessendorf, Andreas Hirsch and Shunichi Fukuzumi. Implementation of redox gradients in hydrogen bonded complexes containing N,N-dimethylaniline, flavin and fullerene derivatives, J. Mater. Chem., 2010, 20, 1457. |
|---|---|
| Market Analysis Reports |