| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(1,3-benzothiazol-2-yl)-2,2-dimethyl-propan-1-ol |
|---|---|
| Synonyms | 1-(benzo[d]thiazol-2-yl)-2,2-dimethylpropan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 |
| CAS Registry Number | 96409-47-1 |
| SMILES | CC(C)(C)C(O)c1nc2ccccc2s1 |
| InChI | 1S/C12H15NOS/c1-12(2,3)10(14)11-13-8-6-4-5-7-9(8)15-11/h4-7,10,14H,1-3H3 |
| InChIKey | CADSICHODYBFCG-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.326°C at 760 mmHg (Cal.) |
| Flash point | 149.947°C (Cal.) |
| (1) | Y. Hirono, K. Kobayashi, M. Yonemoto and Y. Kondo. Metal-free deprotonative functionalization of heteroaromatics using organic superbase catalyst , Chem. Commun., 2010 |
|---|---|
| Market Analysis Reports |