|
CAS#: 97073-72-8 Product: 4,7-Dimethyl-5,6-Dihydroxytryptamine No suppilers available for the product. |
| Name | 4,7-Dimethyl-5,6-Dihydroxytryptamine |
|---|---|
| Synonyms | 4,7-Dime-5,6-Dht; 4,7-Dimethyl-5,6-Dihydroxytryptamine; 4H-Imidazol-4-One, 2-Amino-1,5-Dihydro-1-Methyl-, Compd. With 3-(2-Aminoethyl)-4,7-Dimethyl-1H-Indole-5,6-Diol Sulfate (Salt) (1:1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 97073-72-8 |
| SMILES | C2=C(C1=C(C(=C(O)C(=C1[NH]2)C)O)C)CCN |
| InChI | 1S/C12H16N2O2/c1-6-9-8(3-4-13)5-14-10(9)7(2)12(16)11(6)15/h5,14-16H,3-4,13H2,1-2H3 |
| InChIKey | ZPYZCLCQXCZFIP-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.079°C at 760 mmHg (Cal.) |
| Flash point | 231.443°C (Cal.) |
| Market Analysis Reports |