| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Methylenebis(4-Phenyl Isocyanate) |
|---|---|
| Synonyms | 1-Isocyanato-4-(4-Isocyanatobenzyl)Benzene; Inchi=1/C15h10n2o2/C18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/H1-8H,9H; Methylene Diphenyl Diisocyanate And Polymeric Methylene Diphenyl Diisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 |
| CAS Registry Number | 97568-33-7 (65916-89-4) |
| SMILES | O=C=NC2=CC=C(CC1=CC=C(C=C1)N=C=O)C=C2 |
| InChI | 1S/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
| InChIKey | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| 20 (Expl.) | |
| Melting point | 41°C (Expl.) |
| Boiling point | 373.4±35.0°C at 760 mmHg (Cal.) |
| 313.8889°C (Expl.) | |
| Flash point | 154.0±31.3°C (Cal.) |
| 198.8889°C (Expl.) | |
| solubility | 0.2% |
| Safety Code | S23;S36/37;S45 Details |
|---|---|
| Risk Code | R20;R36/37/38;R40;R42/43;R48/20 Details |
| Hazard Symbol | X Details |
| Transport Information | UN2811 |
| Safety Description | HARMFUL / IRRITANT |
| (1) | János Bozi and Marianne Blazsó. Catalytic modification of pyrolysis products of nitrogen-containing polymers over Y zeolites, Green Chem., 2009, 11, 1638. |
|---|---|
| Market Analysis Reports |