| Atlantic Research Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (8707) 746-454 | |||
![]() |
info@atlantic-chemicals.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 3-(4-chlorophenyl)-2-oxopropanoate |
|---|---|
| Synonyms | 3-(4-Chlorophenyl)-2-oxopropionic acid ethyl ester; Ethyl 3-(4-Chlorophenyl)-2-oxopropanoate; Ethyl 3-(4-chlorophenyl)-2-oxopropanoate, tech |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 |
| CAS Registry Number | 99334-10-8 |
| SMILES | CCOC(=O)C(=O)CC1=CC=C(C=C1)Cl |
| InChI | 1S/C11H11ClO3/c1-2-15-11(14)10(13)7-8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | SSYWONPQBLHLSL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 134.4±22.2°C (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Patricia Busca, Francesca Paradisi, Eamonn Moynihan, Anita R. Maguire and Paul C. Engel. Enantioselective synthesis of non-natural amino acids using phenylalanine dehydrogenases modified by site-directed mutagenesis, Org. Biomol. Chem., 2004, 2, 2684. |
|---|---|
| Market Analysis Reports |