| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Silane reagent |
|---|---|
| Name | Hexaethyldisiloxane |
| Synonyms | Triethyl-Triethylsilyloxy-Silane; 1,1,1,3,3,3-Hexaethyldisiloxane; 52042_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C12H30OSi2 |
| Molecular Weight | 246.54 |
| CAS Registry Number | 994-49-0 |
| EINECS | 213-619-8 |
| SMILES | C([Si](O[Si](CC)(CC)CC)(CC)CC)C |
| InChI | 1S/C12H30OSi2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h7-12H2,1-6H3 |
| InChIKey | WILBTFWIBAOWLN-UHFFFAOYSA-N |
| Density | 0.8±0.1g/cm3 (Cal.) |
|---|---|
| 0.84 (Expl.) | |
| Melting point | -115°C (Expl.) |
| Boiling point | 231°C (Expl.) |
| 234.499°C at 760 mmHg (Cal.) | |
| Flash point | 87°C (Expl.) |
| 77.0±18.8°C (Cal.) | |
| Refractive index | 1.433 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| (1) | Rémi Aouzal and Joëlle Prunet. Synthesis of functionalized Morita–Baylis–Hillman adducts by a conjugate addition–elimination sequence, Org. Biomol. Chem., 2009, 7, 3594. |
|---|---|
| Market Analysis Reports |