| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Dimethyl 2-bromo-2-(bromomethyl)succinate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Br2O4 |
| Molecular Weight | 317.96 |
| CAS Registry Number | 99523-16-7 |
| SMILES | COC(=O)CC(CBr)(C(=O)OC)Br |
| InChI | 1S/C7H10Br2O4/c1-12-5(10)3-7(9,4-8)6(11)13-2/h3-4H2,1-2H3 |
| InChIKey | NVLKUHRSYHVQPD-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.1±40.0°C at 760 mmHg (Cal.) |
| Flash point | 126.8±27.3°C (Cal.) |
| (1) | Thomas Buttler, Ian Fleming, Sabine Gonsior, Bo-Hye Kim, A.-Young Sung and Hee-Gweon Woo. A synthesis of (±)-sparteine, Org. Biomol. Chem., 2005, 3, 1557. |
|---|---|
| Market Analysis Reports |