| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Columbianetin |
|---|---|
| Synonyms | 8-(1-Hydroxy-1-Methyl-Ethyl)-8,9-Dihydrofuro[2,3-H]Chromen-2-One; 8-(1-Hydroxy-1-Methylethyl)-8,9-Dihydrofuro[2,3-H]Chromen-2-One; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 8,9-Dihydro-8-(1-Hydroxy-1-Methylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 |
| CAS Registry Number | 1147-29-1 |
| SMILES | C3=C1OC(C(O)(C)C)CC1=C2OC(=O)C=CC2=C3 |
| InChI | 1S/C14H14O4/c1-14(2,16)11-7-9-10(17-11)5-3-8-4-6-12(15)18-13(8)9/h3-6,11,16H,7H2,1-2H3 |
| InChIKey | YRAQEMCYCSSHJG-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.01°C at 760 mmHg (Cal.) |
| Flash point | 171.938°C (Cal.) |
| (1) | Harris Eric B.J., Banwell Martin G., Willis Anthony C.. Protecting group free syntheses of (±)-columbianetin and (±)-angelmarin, Tetrahedron Letters, 2011 |
|---|---|
| Market Analysis Reports |