| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Columbium Oxalate |
| Synonyms | Ethanedioate; Niobium(+2) Cation; Ethanedioic Acid, Niobium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C2NbO4 |
| Molecular Weight | 180.93 |
| CAS Registry Number | 21348-59-4 |
| EINECS | 244-341-5 |
| SMILES | [Nb++].O=C([O-])C(=O)[O-] |
| InChI | 1S/C2H2O4.Nb/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
| InChIKey | NAIRZPRKOQHYBO-UHFFFAOYSA-L |
| Boiling point | 365.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 188.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |