| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,2-Benzenedicarboxylic acid dimethyl ester, mixt. with pentachlorophenol and 1,1'-(2,2,2-trichloroethylidene)bis(4-methoxybenzene) |
|---|---|
| Synonyms | Benzene-1,2-Dicarboxylic Acid Dimethyl Ester; 1-Methoxy-4-[2,2,2-Trichloro-1-(4-Methoxyphenyl)Ethyl]Benzene; 2,3,4,5,6-Pentachlorophenol; Antox W; 1,2-Benzenedicarboxylic Acid, Dimethyl Ester, Mixt. With Pentachlorophenol And 1,1'-(2,2,2-Trichloroethylidene)Bis(4-Methoxybenzene) |
| Molecular Structure | ![]() |
| Molecular Formula | C32H26Cl8O7 |
| Molecular Weight | 806.18 |
| CAS Registry Number | 116189-57-2 |
| SMILES | C1(=C(Cl)C(=C(O)C(=C1Cl)Cl)Cl)Cl.C3=C(C(C(Cl)(Cl)Cl)C2=CC=C(OC)C=C2)C=CC(=C3)OC.C4=C(C(=CC=C4)C(OC)=O)C(OC)=O |
| InChI | 1S/C16H15Cl3O2.C10H10O4.C6HCl5O/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12;1-13-9(11)7-5-3-4-6-8(7)10(12)14-2;7-1-2(8)4(10)6(12)5(11)3(1)9/h3-10,15H,1-2H3;3-6H,1-2H3;12H |
| InChIKey | DLILBKGBBLFHNW-UHFFFAOYSA-N |
| Boiling point | 436.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 149.4°C (Cal.) |
| Market Analysis Reports |