|
CAS#: 124986-26-1 Product: 4,9-Dihydroxy-6,7-Bis(2-Hydroxypropyl)-1,5,8,12-Tetramethoxyperylene-3,10-Dione No suppilers available for the product. |
| Name | 4,9-Dihydroxy-6,7-Bis(2-Hydroxypropyl)-1,5,8,12-Tetramethoxyperylene-3,10-Dione |
|---|---|
| Synonyms | 4,9-Dihydroxy-6,7-Bis(2-Hydroxypropyl)-1,5,8,12-Tetramethoxy-Perylene-3,10-Dione; 4,9-Dihydroxy-6,7-Bis(2-Hydroxypropyl)-1,5,8,12-Tetramethoxy-Perylene-3,10-Quinone; 3,10-Perylenedione, 4,9-Dihydroxy-1,12-Bis(2-Hydroxypropyl)-2,6,7,11-Tetramethoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H30O10 |
| Molecular Weight | 550.56 |
| CAS Registry Number | 124986-26-1 |
| SMILES | C(C1=C(OC)C(=C4C3=C1C2=C(C(=C(C5=C2C(=C3C(=CC4=O)OC)C(=CC5=O)OC)O)OC)CC(O)C)O)C(O)C |
| InChI | 1S/C30H30O10/c1-11(31)7-13-19-20-14(8-12(2)32)30(40-6)28(36)22-16(34)10-18(38-4)24(26(20)22)23-17(37-3)9-15(33)21(25(19)23)27(35)29(13)39-5/h9-12,31-32,35-36H,7-8H2,1-6H3 |
| InChIKey | WJBHEYCJMSCKIP-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 878.394°C at 760 mmHg (Cal.) |
| Flash point | 291.413°C (Cal.) |
| (1) | Arnone Alberto, Camarda Lorenzo, Nasini Gianluca, Merlini Lucio. Secondary mould metabolites. Part 13. Fungal perylenequinones: phleichrome, isophleichrome, and their endoperoxides, Journal of the Chemical Society, Perkin Transactions 1, 1985 |
|---|---|
| Market Analysis Reports |