| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 9-Anthroic acid methyl ester |
|---|---|
| Synonyms | 9-Anthracenecarboxylic Acid Methyl Ester; Anthracene-9-Carboxylic Acid Methyl Ester; Zinc00400397 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 1504-39-8 |
| SMILES | C2=CC=CC3=CC1=CC=CC=C1C(=C23)C(OC)=O |
| InChI | 1S/C16H12O2/c1-18-16(17)15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-10H,1H3 |
| InChIKey | PHOYNPDEAQEHQR-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.366°C at 760 mmHg (Cal.) |
| Flash point | 194.335°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | I. Zouev, Den-Ke Cao, T. V. Sreevidya, M. Telzhensky, M. Botoshansky and M. Kaftory. Photodimerization of anthracene derivatives in their neat solid state and in solid molecular compounds, CrystEngComm, 2011, 13, 4376. |
|---|---|
| Market Analysis Reports |