| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1-Anthrol |
|---|---|
| Synonyms | 1-Anthracenol; 1-Anthrol; Anthrol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O |
| Molecular Weight | 194.23 |
| CAS Registry Number | 610-50-4 |
| SMILES | C1=C2C(=CC=C1)C=C3C(=C2)C=CC=C3O |
| InChI | 1S/C14H10O/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9,15H |
| InChIKey | MUVQKFGNPGZBII-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.508°C at 760 mmHg (Cal.) |
| Flash point | 197.72°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Zhi-Qiang Wang, Yun Liang, Yong Lei, Ming-Bo Zhou and Jin-Heng Li. Iron-catalyzed annulations of 2-(2-alkynyl)phenoxy)-1-arylethanones leading to substituted naphthalen-1-ols, Chem. Commun., 2009, 5242. |
|---|---|
| Market Analysis Reports |