Online Database of Chemicals from Around the World
| Achemica | Switzerland | |||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
|
+91 (40) 6661-1133 | |||
|
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-Nitrophenyl Azide |
|---|---|
| Synonyms | 1-Azido-2-Nitro-Benzene; Nsc 19923; O-Nitrophenyl Azide |
| Molecular Structure |  |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 |
| CAS Registry Number | 1516-58-1 |
| SMILES | [N+](=NC1=C(C=CC=C1)[N+]([O-])=O)=[N-] |
| InChI | 1S/C6H4N4O2/c7-9-8-5-3-1-2-4-6(5)10(11)12/h1-4H |
| InChIKey | QJGDGUBLGKFNDB-UHFFFAOYSA-N |
| (1) | Giovanni Palmisano, Elisa García-López, Giuseppe Marcì, Vittorio Loddo, Sedat Yurdakal, Vincenzo Augugliaro and Leonardo Palmisano. Advances in selective conversions by heterogeneous photocatalysis, Chem. Commun., 2010, 46, 7074. |
|---|---|
| Market Analysis Reports |