| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 3-Nitrophenyl Azide |
|---|---|
| Synonyms | 1-Azido-3-Nitro-Benzene; 3-Nitrophenyl Azide; T0400-4302 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 |
| CAS Registry Number | 1516-59-2 |
| SMILES | [N+](=NC1=CC=CC(=C1)[N+]([O-])=O)=[N-] |
| InChI | 1S/C6H4N4O2/c7-9-8-5-2-1-3-6(4-5)10(11)12/h1-4H |
| InChIKey | AMLBZFBNQYJIRI-UHFFFAOYSA-N |
| (1) | Zhong-Xia Wang and Hua-Li Qin. Regioselective synthesis of 1,2,3-triazole derivatives via 1,3-dipolar cycloaddition reactions in water, Chem. Commun., 2003, 0, 2450. |
|---|---|
| Market Analysis Reports |