| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1H-Benzotriazole-1-Carbonitrile |
|---|---|
| Synonyms | 1H-BENZO[D][1,2,3]TRIAZOLE-1-CARBONITRILE; InChI=1/C7H4N4/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H; ZINC00406327 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4N4 |
| Molecular Weight | 144.13 |
| CAS Registry Number | 15328-32-2 |
| SMILES | C1=CC=C2C(=C1)N=NN2C#N |
| InChI | 1S/C7H4N4/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H |
| InChIKey | JPUHPGALPBINPO-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.7±25.0°C at 760 mmHg (Cal.) |
| Flash point | 135.6±23.2°C (Cal.) |
| Refractive index | 1.724 (Cal.) |
| (1) | Ulf Drechsler, Daniel J. Sandman and Bruce M. Foxman. N-(3-Cyanoprop-2-ynyl)carbazole: synthesis, crystal structure,; and solid-state reactivity, J. Chem. Soc., Perkin Trans. 2, 2001, 0, 581. |
|---|---|
| Market Analysis Reports |