| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| BroadPharm. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 536-7788 | |||
![]() |
sales@broadpharm.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| LeadGen Labs, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 645-8468 | |||
![]() |
info@leadgenlabs.com | |||
| Chemical manufacturer | ||||
| Life Chemicals Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (905) 634-5212 | |||
![]() |
lifechemicals@lifechemicals.com | |||
| Chemical manufacturer since 2004 | ||||
| Name | 1H-Benzotriazolecarboxylic acid |
|---|---|
| Synonyms | Bas 00015436; 1H-Benzotriazole-5-Carboxylic Acid; Oprea1_101982 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 |
| CAS Registry Number | 60932-58-3 |
| EINECS | 262-527-4 |
| SMILES | C1=C(C(O)=O)C=CC2=N[NH]N=C12 |
| InChI | 1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) |
| InChIKey | GUOVBFFLXKJFEE-UHFFFAOYSA-N |
| Density | 1.618g/cm3 (Cal.) |
|---|---|
| Melting point | 300°C (Expl.) |
| Boiling point | 546.865°C at 760 mmHg (Cal.) |
| Flash point | 284.534°C (Cal.) |
| (1) | Werner Uhl, Matthias Voß, Marcus Layh and Friedhelm Rogel. Gallium–gallium bonds as efficient templates for the generation of a large cage containing twelve gallium atoms, Dalton Trans., 2010, 39, 3160. |
|---|---|
| Market Analysis Reports |