| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Valine derivatives |
|---|---|
| Name | L-Norvaline 1,1-Dimethylethyl Ester |
| Synonyms | L-Norvaline, 1,1-Dimethylethyl Ester; L-NORVALINE T-BUTYL ESTER |
| Molecular Structure | ![]() |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.25 |
| CAS Registry Number | 15911-75-8 |
| SMILES | CCC[C@@H](C(=O)OC(C)(C)C)N |
| InChI | 1S/C9H19NO2/c1-5-6-7(10)8(11)12-9(2,3)4/h7H,5-6,10H2,1-4H3/t7-/m0/s1 |
| Market Analysis Reports |