| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Phthalic Acid Disodium Salt |
| Synonyms | 1,2-Benzenedicarboxylic Acid, Disodium Salt |
| Molecular Formula | C8H4Na2O4 |
| Molecular Weight | 210.10 |
| CAS Registry Number | 15968-01-1 |
| EINECS | 240-106-6 |
| SMILES | C1=C(C(=CC=C1)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | 1S/C8H6O4.2Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | HQWKKEIVHQXCPI-UHFFFAOYSA-L |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.7°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |