| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BroadPharm. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 536-7788 | |||
![]() |
sales@broadpharm.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Life Chemicals Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (905) 634-5212 | |||
![]() |
lifechemicals@lifechemicals.com | |||
| Chemical manufacturer since 2004 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | Phthalic Acid |
|---|---|
| Synonyms | 4-09-00-03167 (Beilstein Handbook Reference); Ai3-02409; Acide Phtalique [French] |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 |
| CAS Registry Number | 72845-50-2 |
| SMILES | C1=C(C(=CC=C1)C(O)=O)C(O)=O |
| InChI | 1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | XNGIFLGASWRNHJ-UHFFFAOYSA-N |
| Density | 1.593 (Expl.) |
|---|---|
| 1.5±0.1g/cm3 (Cal.) | |
| Melting point | 210-211°C (Expl.) |
| Boiling point | 378.3±25.0°C at 760 mmHg (Cal.) |
| Flash point | 196.7±19.7°C (Cal.) |
| 168°C (Expl.) | |
| Refractive index | 1.756 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
| WARNING: Irritates lungs, eyes, skin | |
| WARNING: Irritates skin and eyes | |
| (1) | Eliška Bílková, Miloš Sedlák, Bohuslav Dvořák, Karel Ventura, Petr Knotek and Ludvík Beneš. Prednisolone-α-cyclodextrin-star PEG polypseudorotaxanes with controlled drug delivery properties, Org. Biomol. Chem., 2010, 8, 5423. |
|---|---|
| Market Analysis Reports |