| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | cis-1,2-Dihydrocatechol |
|---|---|
| Synonyms | C0143; Cis-Dihydrobenzenediol; Inchi=1/C6h8o2/C7-5-3-1-2-4-6(5)8/H1-8H/T5-,6 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 |
| CAS Registry Number | 17793-95-2 |
| SMILES | [C@@H]1(C=CC=C[C@H]1O)O |
| InChI | 1S/C6H8O2/c7-5-3-1-2-4-6(5)8/h1-8H/t5-,6+ |
| InChIKey | YDRSQRPHLBEPTP-OLQVQODUSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.356°C at 760 mmHg (Cal.) |
| Flash point | 109.503°C (Cal.) |
| (1) | Kerrie A. B. Austin, Jon D. Elsworth, Martin G. Banwell and Anthony C. Willis. Chemoenzymatic and enantiodivergent routes to 1,2-ring-fused bicyclo[2.2.2]octane and related tricyclic frameworks, Org. Biomol. Chem., 2010, 8, 751. |
|---|---|
| Market Analysis Reports |